C16H25F3N4O — CID 95897359
N,N,N'-trimethyl-N'-[(2S)-2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyhex-5-enyl]ethane-1,2-diamine (PubChem CID 95897359) has the molecular formula C16H25F3N4O and a molecular weight of 346.40 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[(2S)-2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyhex-5-enyl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[(2S)-2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyhex-5-enyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 95897359 |
| Molecular Formula | C16H25F3N4O |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N,N,N'-trimethyl-N'-[(2S)-2-[4-(trifluoromethyl)pyrimidin-2-yl]oxyhex-5-enyl]ethane-1,2-diamine |
| SMILES | C=CCC[C@@H](CN(C)CCN(C)C)Oc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H25F3N4O/c1-5-6-7-13(12-23(4)11-10-22(2)3)24-15-20-9-8-14(21-15)16(17,18)19/h5,8-9,13H,1,6-7,10-12H2,2-4H3/t13-/m0/s1 |
| InChIKey | PWTCFSMEVSUGCF-ZDUSSCGKSA-N |
| XLogP | 2.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|