C17H24F3N3O — CID 95897862
(2R)-N,N-dimethyl-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]oxy]hex-5-en-1-amine (PubChem CID 95897862) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]oxy]hex-5-en-1-amine.
| Compound Name | (2R)-N,N-dimethyl-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]oxy]hex-5-en-1-amine |
|---|---|
| PubChem CID | 95897862 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2R)-N,N-dimethyl-2-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]oxy]hex-5-en-1-amine |
| SMILES | C=CCC[C@H](CN(C)C)Oc1nc2c(c(C(F)(F)F)n1)CCCC2 |
| InChI | InChI=1S/C17H24F3N3O/c1-4-5-8-12(11-23(2)3)24-16-21-14-10-7-6-9-13(14)15(22-16)17(18,19)20/h4,12H,1,5-11H2,2-3H3/t12-/m1/s1 |
| InChIKey | MWRXKYOOZJWWKQ-GFCCVEGCSA-N |
| XLogP | 3.65 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|