C24H29NO4 — CID 95897978
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid (PubChem CID 95897978) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid.
| Compound Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid |
|---|---|
| PubChem CID | 95897978 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)nonanoic acid |
| SMILES | CCCCCC[C@H](CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H29NO4/c1-2-3-4-5-10-17(15-23(26)27)25-24(28)29-16-22-20-13-8-6-11-18(20)19-12-7-9-14-21(19)22/h6-9,11-14,17,22H,2-5,10,15-16H2,1H3,(H,25,28)(H,26,27)/t17-/m1/s1 |
| InChIKey | QUVRSYCVENJXLC-QGZVFWFLSA-N |
| XLogP | 5.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|