C15H21N3O3S — CID 95903151
4-[[methyl-[(1R,3S)-3-methylsulfanylcyclopentyl]amino]methyl]-3-nitrobenzamide (PubChem CID 95903151) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-[[methyl-[(1R,3S)-3-methylsulfanylcyclopentyl]amino]methyl]-3-nitrobenzamide.
| Compound Name | 4-[[methyl-[(1R,3S)-3-methylsulfanylcyclopentyl]amino]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 95903151 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-[[methyl-[(1R,3S)-3-methylsulfanylcyclopentyl]amino]methyl]-3-nitrobenzamide |
| SMILES | CS[C@H]1CC[C@@H](N(C)Cc2ccc(C(N)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H21N3O3S/c1-17(12-5-6-13(8-12)22-2)9-11-4-3-10(15(16)19)7-14(11)18(20)21/h3-4,7,12-13H,5-6,8-9H2,1-2H3,(H2,16,19)/t12-,13+/m1/s1 |
| InChIKey | WGRLHAQCJIAQFE-OLZOCXBDSA-N |
| XLogP | 2.41 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|