About 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile
2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile (PubChem CID 95903876) has the molecular formula C10H15N3S
and a molecular weight of 209.32 g/mol. Its IUPAC name is 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile |
| PubChem CID | 95903876 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile |
| SMILES | CC[C@](C)(NCC#N)c1nc(C)cs1 |
| InChI | InChI=1S/C10H15N3S/c1-4-10(3,12-6-5-11)9-13-8(2)7-14-9/h7,12H,4,6H2,1-3H3/t10-/m0/s1 |
| InChIKey | MFMIBRJOVYFRKB-JTQLQIEISA-N |
| XLogP | 2.19 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile?
The IUPAC name of 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile (CID 95903876) is 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile.
What is the SMILES notation for 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile?
The canonical SMILES for 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile is CC[C@](C)(NCC#N)c1nc(C)cs1.
What is the InChIKey of 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile?
The InChIKey is MFMIBRJOVYFRKB-JTQLQIEISA-N. The full InChI is InChI=1S/C10H15N3S/c1-4-10(3,12-6-5-11)9-13-8(2)7-14-9/h7,12H,4,6H2,1-3H3/t10-/m0/s1.
What are the key properties of 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile?
2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile has a molecular weight of 209.32 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]amino]acetonitrile is sourced from PubChem (CID 95903876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).