C18H24N4O3 — CID 95904410
1-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]urea (PubChem CID 95904410) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]urea.
| Compound Name | 1-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 95904410 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(1S,3R)-3-methoxy-2,2,3-trimethylcyclobutyl]-3-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]urea |
| SMILES | CO[C@]1(C)C[C@H](NC(=O)Nc2cc(-c3nnco3)ccc2C)C1(C)C |
| InChI | InChI=1S/C18H24N4O3/c1-11-6-7-12(15-22-19-10-25-15)8-13(11)20-16(23)21-14-9-18(4,24-5)17(14,2)3/h6-8,10,14H,9H2,1-5H3,(H2,20,21,23)/t14-,18+/m0/s1 |
| InChIKey | URYRCZKVMKDCPN-KBXCAEBGSA-N |
| XLogP | 3.37 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |