C16H19F3N2O3 — CID 95904468
(3R)-3-(4-hydroxypiperidin-1-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 95904468) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is (3R)-3-(4-hydroxypiperidin-1-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (3R)-3-(4-hydroxypiperidin-1-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95904468 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3R)-3-(4-hydroxypiperidin-1-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | O=C1[C@H](N2CCC(O)CC2)CCN1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2O3/c17-16(18,19)24-13-3-1-2-11(10-13)21-9-6-14(15(21)23)20-7-4-12(22)5-8-20/h1-3,10,12,14,22H,4-9H2/t14-/m1/s1 |
| InChIKey | QAVKHNWBDYBJOQ-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |