About N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide
N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide (PubChem CID 95906083) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide |
| PubChem CID | 95906083 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide |
| SMILES | CO[C@@H](CNC(=O)C1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-13(2,3)11(16-4)9-14-12(15)10-5-7-17-8-6-10/h10-11H,5-9H2,1-4H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | YKCJDNCRYQUXDM-NSHDSACASA-N |
| XLogP | 1.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide?
The IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide (CID 95906083) is N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide.
What is the SMILES notation for N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide?
The canonical SMILES for N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide is CO[C@@H](CNC(=O)C1CCOCC1)C(C)(C)C.
What is the InChIKey of N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide?
The InChIKey is YKCJDNCRYQUXDM-NSHDSACASA-N. The full InChI is InChI=1S/C13H25NO3/c1-13(2,3)11(16-4)9-14-12(15)10-5-7-17-8-6-10/h10-11H,5-9H2,1-4H3,(H,14,15)/t11-/m0/s1.
What are the key properties of N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide?
N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide has a molecular weight of 243.35 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-methoxy-3,3-dimethylbutyl]oxane-4-carboxamide is sourced from PubChem (CID 95906083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).