C13H20N4O4 — CID 95906592
N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 95906592) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95906592 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[(1R,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | CO[C@@]1(C)C[C@@H](NC(=O)c2n[nH]c(C)c2[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C13H20N4O4/c1-7-10(17(19)20)9(16-15-7)11(18)14-8-6-13(4,21-5)12(8,2)3/h8H,6H2,1-5H3,(H,14,18)(H,15,16)/t8-,13+/m1/s1 |
| InChIKey | CZNFCTKYXJQOQN-OQPBUACISA-N |
| XLogP | 1.56 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|