C17H32N2OS2 — CID 95908672
5-[(3S)-dithiolan-3-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide (PubChem CID 95908672) has the molecular formula C17H32N2OS2 and a molecular weight of 344.59 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 95908672 |
| Molecular Formula | C17H32N2OS2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
| SMILES | CC1(C)CC(NC(=O)CCCC[C@H]2CCSS2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H32N2OS2/c1-16(2)11-13(12-17(3,4)19-16)18-15(20)8-6-5-7-14-9-10-21-22-14/h13-14,19H,5-12H2,1-4H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | IBMXIZJZHGEOEH-AWEZNQCLSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|