C11H8F3N5S — CID 95909417
4-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]aniline (PubChem CID 95909417) has the molecular formula C11H8F3N5S and a molecular weight of 299.28 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]aniline.
| Compound Name | 4-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]aniline |
|---|---|
| PubChem CID | 95909417 |
| Molecular Formula | C11H8F3N5S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]aniline |
| SMILES | Nc1ccc(Cc2nn3c(C(F)(F)F)nnc3s2)cc1 |
| InChI | InChI=1S/C11H8F3N5S/c12-11(13,14)9-16-17-10-19(9)18-8(20-10)5-6-1-3-7(15)4-2-6/h1-4H,5,15H2 |
| InChIKey | CWXOMJOPCJZFCO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|