C14H9F3N4O2S — CID 95909491
prop-2-enyl 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzoate (PubChem CID 95909491) has the molecular formula C14H9F3N4O2S and a molecular weight of 354.31 g/mol. Its IUPAC name is prop-2-enyl 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzoate.
| Compound Name | prop-2-enyl 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzoate |
|---|---|
| PubChem CID | 95909491 |
| Molecular Formula | C14H9F3N4O2S |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | prop-2-enyl 3-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzoate |
| SMILES | C=CCOC(=O)c1cccc(-c2nn3c(C(F)(F)F)nnc3s2)c1 |
| InChI | InChI=1S/C14H9F3N4O2S/c1-2-6-23-11(22)9-5-3-4-8(7-9)10-20-21-12(14(15,16)17)18-19-13(21)24-10/h2-5,7H,1,6H2 |
| InChIKey | BFSXFBOKBWMEID-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|