About 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole
2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole (PubChem CID 95909938) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole |
| PubChem CID | 95909938 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole |
| SMILES | CCN1CC=C(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C14H17N3/c1-2-17-9-7-11(8-10-17)14-15-12-5-3-4-6-13(12)16-14/h3-7H,2,8-10H2,1H3,(H,15,16) |
| InChIKey | XDTVADSMQXPUNU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole?
The IUPAC name of 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole (CID 95909938) is 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole.
What is the SMILES notation for 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole?
The canonical SMILES for 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole is CCN1CC=C(c2nc3ccccc3[nH]2)CC1.
What is the InChIKey of 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole?
The InChIKey is XDTVADSMQXPUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-2-17-9-7-11(8-10-17)14-15-12-5-3-4-6-13(12)16-14/h3-7H,2,8-10H2,1H3,(H,15,16).
What are the key properties of 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole?
2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole has a molecular weight of 227.31 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)-1H-benzimidazole is sourced from PubChem (CID 95909938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).