C15H12Br2N2O — CID 95911077
5,7-dibromo-2-(3,5-dimethylphenyl)-1,3-benzoxazol-6-amine (PubChem CID 95911077) has the molecular formula C15H12Br2N2O and a molecular weight of 396.08 g/mol. Its IUPAC name is 5,7-dibromo-2-(3,5-dimethylphenyl)-1,3-benzoxazol-6-amine.
| Compound Name | 5,7-dibromo-2-(3,5-dimethylphenyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 95911077 |
| Molecular Formula | C15H12Br2N2O |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 5,7-dibromo-2-(3,5-dimethylphenyl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc(C)cc(-c2nc3cc(Br)c(N)c(Br)c3o2)c1 |
| InChI | InChI=1S/C15H12Br2N2O/c1-7-3-8(2)5-9(4-7)15-19-11-6-10(16)13(18)12(17)14(11)20-15/h3-6H,18H2,1-2H3 |
| InChIKey | IQZLWWKDNZZUIB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|