C10H13N3O2 — CID 95915738
3-ethyl-5,6-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 95915738) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-5,6-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 95915738 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2cc(C)n(C)c2c1=O |
| InChI | InChI=1S/C10H13N3O2/c1-4-13-9(14)8-7(11-10(13)15)5-6(2)12(8)3/h5H,4H2,1-3H3,(H,11,15) |
| InChIKey | RYMHYBOBYBXEIE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |