About [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine
[4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine (PubChem CID 95915885) has the molecular formula C12H14N4
and a molecular weight of 214.27 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine |
| PubChem CID | 95915885 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1ccc(-c2ccnc(NN)n2)cc1C |
| InChI | InChI=1S/C12H14N4/c1-8-3-4-10(7-9(8)2)11-5-6-14-12(15-11)16-13/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | GAYFGQAVRLYCQF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine?
The IUPAC name of [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine (CID 95915885) is [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine.
What is the SMILES notation for [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine?
The canonical SMILES for [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine is Cc1ccc(-c2ccnc(NN)n2)cc1C.
What is the InChIKey of [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine?
The InChIKey is GAYFGQAVRLYCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4/c1-8-3-4-10(7-9(8)2)11-5-6-14-12(15-11)16-13/h3-7H,13H2,1-2H3,(H,14,15,16).
What are the key properties of [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine?
[4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine has a molecular weight of 214.27 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dimethylphenyl)pyrimidin-2-yl]hydrazine is sourced from PubChem (CID 95915885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).