C13H12FN3O2S — CID 95916166
2-[3-[(2-fluorophenyl)methylamino]pyrazin-2-yl]sulfanylacetic acid (PubChem CID 95916166) has the molecular formula C13H12FN3O2S and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[3-[(2-fluorophenyl)methylamino]pyrazin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[3-[(2-fluorophenyl)methylamino]pyrazin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 95916166 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[3-[(2-fluorophenyl)methylamino]pyrazin-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nccnc1NCc1ccccc1F |
| InChI | InChI=1S/C13H12FN3O2S/c14-10-4-2-1-3-9(10)7-17-12-13(16-6-5-15-12)20-8-11(18)19/h1-6H,7-8H2,(H,15,17)(H,18,19) |
| InChIKey | IYIVTPGDFLOYSZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |