C18H18N4O4 — CID 95917582
2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 95917582) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 95917582 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[4-(3,5-dimethylphenyl)-2,3-dioxopyrazin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(C)cc(-n2ccn(CC(=O)Nc3cc(C)on3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C18H18N4O4/c1-11-6-12(2)8-14(7-11)22-5-4-21(17(24)18(22)25)10-16(23)19-15-9-13(3)26-20-15/h4-9H,10H2,1-3H3,(H,19,20,23) |
| InChIKey | FNJSTMSPURMHSA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|