C19H16F2N2O2 — CID 95917593
1-[(2,5-difluorophenyl)methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione (PubChem CID 95917593) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 95917593 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione |
| SMILES | Cc1cc(C)cc(-n2ccn(Cc3cc(F)ccc3F)c(=O)c2=O)c1 |
| InChI | InChI=1S/C19H16F2N2O2/c1-12-7-13(2)9-16(8-12)23-6-5-22(18(24)19(23)25)11-14-10-15(20)3-4-17(14)21/h3-10H,11H2,1-2H3 |
| InChIKey | YTHZMMSQNMAJOX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|