C20H16ClN3O — CID 95920139
3-benzyl-7-(4-chlorophenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 95920139) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is 3-benzyl-7-(4-chlorophenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-7-(4-chlorophenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 95920139 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 3-benzyl-7-(4-chlorophenyl)-5-methylpyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Cn1cc(-c2ccc(Cl)cc2)c2ncn(Cc3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C20H16ClN3O/c1-23-12-17(15-7-9-16(21)10-8-15)18-19(23)20(25)24(13-22-18)11-14-5-3-2-4-6-14/h2-10,12-13H,11H2,1H3 |
| InChIKey | OBGIZQRMWXOJNQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |