C25H23N7O2S — CID 95920696
5-(3,4-dihydro-1H-isoquinolin-2-yl)-7-methyl-2-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 95920696) has the molecular formula C25H23N7O2S and a molecular weight of 485.57 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isoquinolin-2-yl)-7-methyl-2-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-(3,4-dihydro-1H-isoquinolin-2-yl)-7-methyl-2-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 95920696 |
| Molecular Formula | C25H23N7O2S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 5-(3,4-dihydro-1H-isoquinolin-2-yl)-7-methyl-2-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | CSc1ccc(-c2noc(Cn3nc4cc(C)nc(N5CCc6ccccc6C5)n4c3=O)n2)cc1 |
| InChI | InChI=1S/C25H23N7O2S/c1-16-13-21-28-31(15-22-27-23(29-34-22)18-7-9-20(35-2)10-8-18)25(33)32(21)24(26-16)30-12-11-17-5-3-4-6-19(17)14-30/h3-10,13H,11-12,14-15H2,1-2H3 |
| InChIKey | XYLQIHPAJRFYTB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |