C14H11ClN2O4 — CID 95921246
methyl 1-[2-(4-chlorophenyl)-2-oxoethyl]-6-oxopyrimidine-5-carboxylate (PubChem CID 95921246) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is methyl 1-[2-(4-chlorophenyl)-2-oxoethyl]-6-oxopyrimidine-5-carboxylate.
| Compound Name | methyl 1-[2-(4-chlorophenyl)-2-oxoethyl]-6-oxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 95921246 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | methyl 1-[2-(4-chlorophenyl)-2-oxoethyl]-6-oxopyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cncn(CC(=O)c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C14H11ClN2O4/c1-21-14(20)11-6-16-8-17(13(11)19)7-12(18)9-2-4-10(15)5-3-9/h2-6,8H,7H2,1H3 |
| InChIKey | BAOYVLCLSLHAOI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |