C20H18ClN3O4 — CID 95926400
2-[2-(3-chloro-4-methoxyanilino)-6-(4-methylphenyl)pyrimidin-4-yl]oxyacetic acid (PubChem CID 95926400) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is 2-[2-(3-chloro-4-methoxyanilino)-6-(4-methylphenyl)pyrimidin-4-yl]oxyacetic acid.
| Compound Name | 2-[2-(3-chloro-4-methoxyanilino)-6-(4-methylphenyl)pyrimidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 95926400 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[2-(3-chloro-4-methoxyanilino)-6-(4-methylphenyl)pyrimidin-4-yl]oxyacetic acid |
| SMILES | COc1ccc(Nc2nc(OCC(=O)O)cc(-c3ccc(C)cc3)n2)cc1Cl |
| InChI | InChI=1S/C20H18ClN3O4/c1-12-3-5-13(6-4-12)16-10-18(28-11-19(25)26)24-20(23-16)22-14-7-8-17(27-2)15(21)9-14/h3-10H,11H2,1-2H3,(H,25,26)(H,22,23,24) |
| InChIKey | MJUGYQQCKIHOAN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |