About 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid
2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid (PubChem CID 95927495) has the molecular formula C19H21F3N4O3
and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid |
| PubChem CID | 95927495 |
| Molecular Formula | C19H21F3N4O3 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid |
| SMILES | Cc1ccc(N2CCN(c3nc(OCC(=O)O)cc(C(F)(F)F)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H21F3N4O3/c1-12-3-4-14(13(2)9-12)25-5-7-26(8-6-25)18-23-15(19(20,21)22)10-16(24-18)29-11-17(27)28/h3-4,9-10H,5-8,11H2,1-2H3,(H,27,28) |
| InChIKey | AYDCPELPPYJDOG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid?
The IUPAC name of 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid (CID 95927495) is 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid.
What is the SMILES notation for 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid?
The canonical SMILES for 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid is Cc1ccc(N2CCN(c3nc(OCC(=O)O)cc(C(F)(F)F)n3)CC2)c(C)c1.
What is the InChIKey of 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid?
The InChIKey is AYDCPELPPYJDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N4O3/c1-12-3-4-14(13(2)9-12)25-5-7-26(8-6-25)18-23-15(19(20,21)22)10-16(24-18)29-11-17(27)28/h3-4,9-10H,5-8,11H2,1-2H3,(H,27,28).
What are the key properties of 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid?
2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid has a molecular weight of 410.40 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(2,4-dimethylphenyl)piperazin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]oxyacetic acid is sourced from PubChem (CID 95927495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).