About (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one
(3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one (PubChem CID 95930485) has the molecular formula C19H13NO3S
and a molecular weight of 335.38 g/mol. Its IUPAC name is (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one.
Molecular Properties
| Compound Name | (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one |
| PubChem CID | 95930485 |
| Molecular Formula | C19H13NO3S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one |
| SMILES | O=C1Oc2ccccc2/C1=C/c1ccc(OCc2cscn2)cc1 |
| InChI | InChI=1S/C19H13NO3S/c21-19-17(16-3-1-2-4-18(16)23-19)9-13-5-7-15(8-6-13)22-10-14-11-24-12-20-14/h1-9,11-12H,10H2/b17-9- |
| InChIKey | ZLDWHZUHCIVEMP-MFOYZWKCSA-N |
| XLogP | 4.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one?
The IUPAC name of (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one (CID 95930485) is (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one.
What is the SMILES notation for (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one?
The canonical SMILES for (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one is O=C1Oc2ccccc2/C1=C/c1ccc(OCc2cscn2)cc1.
What is the InChIKey of (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one?
The InChIKey is ZLDWHZUHCIVEMP-MFOYZWKCSA-N. The full InChI is InChI=1S/C19H13NO3S/c21-19-17(16-3-1-2-4-18(16)23-19)9-13-5-7-15(8-6-13)22-10-14-11-24-12-20-14/h1-9,11-12H,10H2/b17-9-.
What are the key properties of (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one?
(3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one has a molecular weight of 335.38 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[[4-(1,3-thiazol-4-ylmethoxy)phenyl]methylidene]-1-benzofuran-2-one is sourced from PubChem (CID 95930485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).