C15H9ClO5 — CID 95931121
2-(chloromethyl)-1,4,5-trihydroxyanthracene-9,10-dione (PubChem CID 95931121) has the molecular formula C15H9ClO5 and a molecular weight of 304.69 g/mol. Its IUPAC name is 2-(chloromethyl)-1,4,5-trihydroxyanthracene-9,10-dione.
| Compound Name | 2-(chloromethyl)-1,4,5-trihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 95931121 |
| Molecular Formula | C15H9ClO5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-(chloromethyl)-1,4,5-trihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2c(O)cccc2C(=O)c2c(O)c(CCl)cc(O)c21 |
| InChI | InChI=1S/C15H9ClO5/c16-5-6-4-9(18)11-12(13(6)19)14(20)7-2-1-3-8(17)10(7)15(11)21/h1-4,17-19H,5H2 |
| InChIKey | YXZJUPRGQIOEBS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|