About ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate
ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate (PubChem CID 95932127) has the molecular formula C18H22FNO3
and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate |
| PubChem CID | 95932127 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)N2C[C@H](c3ccc(F)cc3)C[C@@H]2C)CC1 |
| InChI | InChI=1S/C18H22FNO3/c1-3-23-17(22)18(8-9-18)16(21)20-11-14(10-12(20)2)13-4-6-15(19)7-5-13/h4-7,12,14H,3,8-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | VAZIVHIONLLITJ-GXTWGEPZSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate (CID 95932127) is ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate is CCOC(=O)C1(C(=O)N2C[C@H](c3ccc(F)cc3)C[C@@H]2C)CC1.
What is the InChIKey of ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate?
The InChIKey is VAZIVHIONLLITJ-GXTWGEPZSA-N. The full InChI is InChI=1S/C18H22FNO3/c1-3-23-17(22)18(8-9-18)16(21)20-11-14(10-12(20)2)13-4-6-15(19)7-5-13/h4-7,12,14H,3,8-11H2,1-2H3/t12-,14+/m0/s1.
What are the key properties of ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate?
ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate has a molecular weight of 319.38 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2S,4S)-4-(4-fluorophenyl)-2-methylpyrrolidine-1-carbonyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 95932127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).