C14H16F3N3O4 — CID 95932170
N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2-nitro-4-(trifluoromethyl)benzamide (PubChem CID 95932170) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2-nitro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2-nitro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 95932170 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[(2S,3S)-1-amino-3-methyl-1-oxopentan-2-yl]-2-nitro-4-(trifluoromethyl)benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C14H16F3N3O4/c1-3-7(2)11(12(18)21)19-13(22)9-5-4-8(14(15,16)17)6-10(9)20(23)24/h4-7,11H,3H2,1-2H3,(H2,18,21)(H,19,22)/t7-,11-/m0/s1 |
| InChIKey | IYIGFPJHLNFPCQ-CPCISQLKSA-N |
| XLogP | 2.24 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|