About [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine
[(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine (PubChem CID 95933677) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine.
Molecular Properties
| Compound Name | [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine |
| PubChem CID | 95933677 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine |
| SMILES | CC[C@@H]1[C@@H](CN)CCCCN1c1ccn[nH]1 |
| InChI | InChI=1S/C12H22N4/c1-2-11-10(9-13)5-3-4-8-16(11)12-6-7-14-15-12/h6-7,10-11H,2-5,8-9,13H2,1H3,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | URFPFOJSTNQTFF-GHMZBOCLSA-N |
| XLogP | 1.75 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine?
The IUPAC name of [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine (CID 95933677) is [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine.
What is the SMILES notation for [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine?
The canonical SMILES for [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine is CC[C@@H]1[C@@H](CN)CCCCN1c1ccn[nH]1.
What is the InChIKey of [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine?
The InChIKey is URFPFOJSTNQTFF-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H22N4/c1-2-11-10(9-13)5-3-4-8-16(11)12-6-7-14-15-12/h6-7,10-11H,2-5,8-9,13H2,1H3,(H,14,15)/t10-,11-/m1/s1.
What are the key properties of [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine?
[(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine has a molecular weight of 222.34 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-ethyl-1-(1H-pyrazol-5-yl)azepan-3-yl]methanamine is sourced from PubChem (CID 95933677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).