C12H19NO2 — CID 95934404
[1-[(1S)-1-(furan-2-yl)ethyl]piperidin-4-yl]methanol (PubChem CID 95934404) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [1-[(1S)-1-(furan-2-yl)ethyl]piperidin-4-yl]methanol.
| Compound Name | [1-[(1S)-1-(furan-2-yl)ethyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 95934404 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [1-[(1S)-1-(furan-2-yl)ethyl]piperidin-4-yl]methanol |
| SMILES | C[C@@H](c1ccco1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C12H19NO2/c1-10(12-3-2-8-15-12)13-6-4-11(9-14)5-7-13/h2-3,8,10-11,14H,4-7,9H2,1H3/t10-/m0/s1 |
| InChIKey | KWFUASMUGDQTFW-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |