C6H8F3N3O — CID 95935056
(1S)-2-amino-1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethanol (PubChem CID 95935056) has the molecular formula C6H8F3N3O and a molecular weight of 195.14 g/mol. Its IUPAC name is (1S)-2-amino-1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethanol.
| Compound Name | (1S)-2-amino-1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethanol |
|---|---|
| PubChem CID | 95935056 |
| Molecular Formula | C6H8F3N3O |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (1S)-2-amino-1-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethanol |
| SMILES | NC[C@@H](O)c1cn[nH]c1C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O/c7-6(8,9)5-3(2-11-12-5)4(13)1-10/h2,4,13H,1,10H2,(H,11,12)/t4-/m1/s1 |
| InChIKey | COQPOIURQWZFFV-SCSAIBSYSA-N |
| XLogP | 0.42 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |