C18H27NO3S — CID 95935278
1-[(3S,4S)-3-ethyl-4-phenylpiperidin-1-yl]-2-propylsulfonylethanone (PubChem CID 95935278) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[(3S,4S)-3-ethyl-4-phenylpiperidin-1-yl]-2-propylsulfonylethanone.
| Compound Name | 1-[(3S,4S)-3-ethyl-4-phenylpiperidin-1-yl]-2-propylsulfonylethanone |
|---|---|
| PubChem CID | 95935278 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[(3S,4S)-3-ethyl-4-phenylpiperidin-1-yl]-2-propylsulfonylethanone |
| SMILES | CCCS(=O)(=O)CC(=O)N1CC[C@H](c2ccccc2)[C@H](CC)C1 |
| InChI | InChI=1S/C18H27NO3S/c1-3-12-23(21,22)14-18(20)19-11-10-17(15(4-2)13-19)16-8-6-5-7-9-16/h5-9,15,17H,3-4,10-14H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | CLMGDPRPYQZWFR-WBVHZDCISA-N |
| XLogP | 2.85 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |