About N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide
N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide (PubChem CID 95935306) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide |
| PubChem CID | 95935306 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide |
| SMILES | CCc1noc(CO/N=C(\N)c2ccccc2)n1 |
| InChI | InChI=1S/C12H14N4O2/c1-2-10-14-11(18-15-10)8-17-16-12(13)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,16) |
| InChIKey | SJHDSAXPWBJERY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide?
The IUPAC name of N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide (CID 95935306) is N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide.
What is the SMILES notation for N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide?
The canonical SMILES for N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide is CCc1noc(CO/N=C(\N)c2ccccc2)n1.
What is the InChIKey of N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide?
The InChIKey is SJHDSAXPWBJERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-2-10-14-11(18-15-10)8-17-16-12(13)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,13,16).
What are the key properties of N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide?
N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide has a molecular weight of 246.27 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-ethyl-1,2,4-oxadiazol-5-yl)methoxy]benzenecarboximidamide is sourced from PubChem (CID 95935306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).