About 3-(4-methylphenyl)sulfonyl-1,3-oxazinane
3-(4-methylphenyl)sulfonyl-1,3-oxazinane (PubChem CID 959536) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)sulfonyl-1,3-oxazinane |
| PubChem CID | 959536 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-1,3-oxazinane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCOC2)cc1 |
| InChI | InChI=1S/C11H15NO3S/c1-10-3-5-11(6-4-10)16(13,14)12-7-2-8-15-9-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | BYTYRIZQSLBUCN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-methylphenyl)sulfonyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)sulfonyl-1,3-oxazinane?
The IUPAC name of 3-(4-methylphenyl)sulfonyl-1,3-oxazinane (CID 959536) is 3-(4-methylphenyl)sulfonyl-1,3-oxazinane.
What is the SMILES notation for 3-(4-methylphenyl)sulfonyl-1,3-oxazinane?
The canonical SMILES for 3-(4-methylphenyl)sulfonyl-1,3-oxazinane is Cc1ccc(S(=O)(=O)N2CCCOC2)cc1.
What is the InChIKey of 3-(4-methylphenyl)sulfonyl-1,3-oxazinane?
The InChIKey is BYTYRIZQSLBUCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-10-3-5-11(6-4-10)16(13,14)12-7-2-8-15-9-12/h3-6H,2,7-9H2,1H3.
What are the key properties of 3-(4-methylphenyl)sulfonyl-1,3-oxazinane?
3-(4-methylphenyl)sulfonyl-1,3-oxazinane has a molecular weight of 241.31 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)sulfonyl-1,3-oxazinane is sourced from PubChem (CID 959536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).