C12H14ClN5OS — CID 959578
2-(4-chlorophenyl)sulfanyl-N-(2-propyltetrazol-5-yl)acetamide (PubChem CID 959578) has the molecular formula C12H14ClN5OS and a molecular weight of 311.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(2-propyltetrazol-5-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(2-propyltetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 959578 |
| Molecular Formula | C12H14ClN5OS |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(2-propyltetrazol-5-yl)acetamide |
| SMILES | CCCn1nnc(NC(=O)CSc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H14ClN5OS/c1-2-7-18-16-12(15-17-18)14-11(19)8-20-10-5-3-9(13)4-6-10/h3-6H,2,7-8H2,1H3,(H,14,16,19) |
| InChIKey | YZJVKLPTIFEYFV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |