About 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one
5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one (PubChem CID 95967740) has the molecular formula C17H21N3O2S
and a molecular weight of 331.44 g/mol. Its IUPAC name is 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one |
| PubChem CID | 95967740 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1ccc(-n2[nH]c(C(=O)N3CCS[C@H](C)[C@H]3C)cc2=O)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-11-4-6-14(7-5-11)20-16(21)10-15(18-20)17(22)19-8-9-23-13(3)12(19)2/h4-7,10,12-13,18H,8-9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | BPGQOUYFRJWEND-CHWSQXEVSA-N |
| XLogP | 2.44 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one?
The IUPAC name of 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one (CID 95967740) is 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one.
What is the SMILES notation for 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one?
The canonical SMILES for 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one is Cc1ccc(-n2[nH]c(C(=O)N3CCS[C@H](C)[C@H]3C)cc2=O)cc1.
What is the InChIKey of 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one?
The InChIKey is BPGQOUYFRJWEND-CHWSQXEVSA-N. The full InChI is InChI=1S/C17H21N3O2S/c1-11-4-6-14(7-5-11)20-16(21)10-15(18-20)17(22)19-8-9-23-13(3)12(19)2/h4-7,10,12-13,18H,8-9H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one?
5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one has a molecular weight of 331.44 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,3R)-2,3-dimethylthiomorpholine-4-carbonyl]-2-(4-methylphenyl)-1H-pyrazol-3-one is sourced from PubChem (CID 95967740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).