C15H28N2O3S — CID 95968828
(3aR,7aS)-N-(2-tert-butylsulfonylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 95968828) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is (3aR,7aS)-N-(2-tert-butylsulfonylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3aR,7aS)-N-(2-tert-butylsulfonylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 95968828 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3aR,7aS)-N-(2-tert-butylsulfonylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | CC(C)(C)S(=O)(=O)CCNC(=O)N1CC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H28N2O3S/c1-15(2,3)21(19,20)11-9-16-14(18)17-10-8-12-6-4-5-7-13(12)17/h12-13H,4-11H2,1-3H3,(H,16,18)/t12-,13+/m1/s1 |
| InChIKey | QVVIUVJQTXPOMW-OLZOCXBDSA-N |
| XLogP | 2.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |