C13H17FN2O3S — CID 95968959
methyl (3R)-3-fluoro-1-[(5-methylthiophen-2-yl)methylcarbamoyl]pyrrolidine-3-carboxylate (PubChem CID 95968959) has the molecular formula C13H17FN2O3S and a molecular weight of 300.35 g/mol. Its IUPAC name is methyl (3R)-3-fluoro-1-[(5-methylthiophen-2-yl)methylcarbamoyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-3-fluoro-1-[(5-methylthiophen-2-yl)methylcarbamoyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 95968959 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | methyl (3R)-3-fluoro-1-[(5-methylthiophen-2-yl)methylcarbamoyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@]1(F)CCN(C(=O)NCc2ccc(C)s2)C1 |
| InChI | InChI=1S/C13H17FN2O3S/c1-9-3-4-10(20-9)7-15-12(18)16-6-5-13(14,8-16)11(17)19-2/h3-4H,5-8H2,1-2H3,(H,15,18)/t13-/m1/s1 |
| InChIKey | DKZLNANRALAJPM-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |