About (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide
(2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 95969227) has the molecular formula C13H24N2O2S
and a molecular weight of 272.41 g/mol. Its IUPAC name is (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| PubChem CID | 95969227 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CCS[C@@H]1CC[C@@H](NC(=O)N2CCC[C@@H]2CO)C1 |
| InChI | InChI=1S/C13H24N2O2S/c1-2-18-12-6-5-10(8-12)14-13(17)15-7-3-4-11(15)9-16/h10-12,16H,2-9H2,1H3,(H,14,17)/t10-,11-,12-/m1/s1 |
| InChIKey | VKVIQZULNZXJAG-IJLUTSLNSA-N |
| XLogP | 1.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide?
The IUPAC name of (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (CID 95969227) is (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide?
The canonical SMILES for (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide is CCS[C@@H]1CC[C@@H](NC(=O)N2CCC[C@@H]2CO)C1.
What is the InChIKey of (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide?
The InChIKey is VKVIQZULNZXJAG-IJLUTSLNSA-N. The full InChI is InChI=1S/C13H24N2O2S/c1-2-18-12-6-5-10(8-12)14-13(17)15-7-3-4-11(15)9-16/h10-12,16H,2-9H2,1H3,(H,14,17)/t10-,11-,12-/m1/s1.
What are the key properties of (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide?
(2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide has a molecular weight of 272.41 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(1R,3R)-3-ethylsulfanylcyclopentyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 95969227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).