C8H17N — CID 95970339
(3R,5S)-3,5-dimethylazepane (PubChem CID 95970339) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethylazepane.
| Compound Name | (3R,5S)-3,5-dimethylazepane |
|---|---|
| PubChem CID | 95970339 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (3R,5S)-3,5-dimethylazepane |
| SMILES | C[C@@H]1CCNC[C@H](C)C1 |
| InChI | InChI=1S/C8H17N/c1-7-3-4-9-6-8(2)5-7/h7-9H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | JUFCUCAZFRNTIB-HTQZYQBOSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |