About N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide
N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide (PubChem CID 95970906) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide |
| PubChem CID | 95970906 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide |
| SMILES | CO[C@@H](CNS(=O)(=O)c1cccnc1)C(C)(C)C |
| InChI | InChI=1S/C12H20N2O3S/c1-12(2,3)11(17-4)9-14-18(15,16)10-6-5-7-13-8-10/h5-8,11,14H,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | AKMKSFKTZXJPRO-NSHDSACASA-N |
| XLogP | 1.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide?
The IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide (CID 95970906) is N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide.
What is the SMILES notation for N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide?
The canonical SMILES for N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide is CO[C@@H](CNS(=O)(=O)c1cccnc1)C(C)(C)C.
What is the InChIKey of N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide?
The InChIKey is AKMKSFKTZXJPRO-NSHDSACASA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-12(2,3)11(17-4)9-14-18(15,16)10-6-5-7-13-8-10/h5-8,11,14H,9H2,1-4H3/t11-/m0/s1.
What are the key properties of N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide?
N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide has a molecular weight of 272.37 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-methoxy-3,3-dimethylbutyl]pyridine-3-sulfonamide is sourced from PubChem (CID 95970906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).