About (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide
(2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide (PubChem CID 95971463) has the molecular formula C16H22ClNO3
and a molecular weight of 311.81 g/mol. Its IUPAC name is (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide |
| PubChem CID | 95971463 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide |
| SMILES | C[C@H](c1ccc(Cl)cc1)[C@@H](C)N(C)C(=O)[C@@H]1COCCO1 |
| InChI | InChI=1S/C16H22ClNO3/c1-11(13-4-6-14(17)7-5-13)12(2)18(3)16(19)15-10-20-8-9-21-15/h4-7,11-12,15H,8-10H2,1-3H3/t11-,12+,15-/m0/s1 |
| InChIKey | GUPQIIZJHHPVCO-ZOWXZIJZSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The IUPAC name of (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide (CID 95971463) is (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide.
What is the SMILES notation for (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The canonical SMILES for (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide is C[C@H](c1ccc(Cl)cc1)[C@@H](C)N(C)C(=O)[C@@H]1COCCO1.
What is the InChIKey of (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The InChIKey is GUPQIIZJHHPVCO-ZOWXZIJZSA-N. The full InChI is InChI=1S/C16H22ClNO3/c1-11(13-4-6-14(17)7-5-13)12(2)18(3)16(19)15-10-20-8-9-21-15/h4-7,11-12,15H,8-10H2,1-3H3/t11-,12+,15-/m0/s1.
What are the key properties of (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide?
(2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide has a molecular weight of 311.81 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2R,3R)-3-(4-chlorophenyl)butan-2-yl]-N-methyl-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 95971463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).