About [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone
[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 95971949) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone |
| PubChem CID | 95971949 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC(C)[C@@H]1CN(C(=O)c2ccn[nH]2)c2ccccc2N1 |
| InChI | InChI=1S/C15H18N4O/c1-10(2)13-9-19(15(20)12-7-8-16-18-12)14-6-4-3-5-11(14)17-13/h3-8,10,13,17H,9H2,1-2H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | JZLITFQLMHDHSK-ZDUSSCGKSA-N |
| XLogP | 2.51 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone?
The IUPAC name of [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone (CID 95971949) is [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone.
What is the SMILES notation for [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone?
The canonical SMILES for [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone is CC(C)[C@@H]1CN(C(=O)c2ccn[nH]2)c2ccccc2N1.
What is the InChIKey of [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone?
The InChIKey is JZLITFQLMHDHSK-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H18N4O/c1-10(2)13-9-19(15(20)12-7-8-16-18-12)14-6-4-3-5-11(14)17-13/h3-8,10,13,17H,9H2,1-2H3,(H,16,18)/t13-/m0/s1.
What are the key properties of [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone?
[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone has a molecular weight of 270.34 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-(1H-pyrazol-5-yl)methanone is sourced from PubChem (CID 95971949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).