C12H9Cl3N4O — CID 95972383
(6R)-3-methyl-6-(trichloromethyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one (PubChem CID 95972383) has the molecular formula C12H9Cl3N4O and a molecular weight of 331.59 g/mol. Its IUPAC name is (6R)-3-methyl-6-(trichloromethyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one.
| Compound Name | (6R)-3-methyl-6-(trichloromethyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one |
|---|---|
| PubChem CID | 95972383 |
| Molecular Formula | C12H9Cl3N4O |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | (6R)-3-methyl-6-(trichloromethyl)-6,7-dihydro-[1,2,4]triazino[2,3-c]quinazolin-2-one |
| SMILES | Cc1nn2c(nc1=O)-c1ccccc1N[C@H]2C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H9Cl3N4O/c1-6-10(20)17-9-7-4-2-3-5-8(7)16-11(12(13,14)15)19(9)18-6/h2-5,11,16H,1H3/t11-/m1/s1 |
| InChIKey | FRYRIDRPJQNUIF-LLVKDONJSA-N |
| XLogP | 2.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|