C13H17ClN2O2S — CID 95972424
2-chloro-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]pyridine-3-carboxamide (PubChem CID 95972424) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 2-chloro-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95972424 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-chloro-N-[[(1R,2S)-2-ethylsulfanyl-1-hydroxycyclobutyl]methyl]pyridine-3-carboxamide |
| SMILES | CCS[C@H]1CC[C@@]1(O)CNC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C13H17ClN2O2S/c1-2-19-10-5-6-13(10,18)8-16-12(17)9-4-3-7-15-11(9)14/h3-4,7,10,18H,2,5-6,8H2,1H3,(H,16,17)/t10-,13+/m0/s1 |
| InChIKey | JKGHJAPBFQRVSH-GXFFZTMASA-N |
| XLogP | 2.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|