About [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate
[(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate (PubChem CID 95973434) has the molecular formula C20H18F2N2O2
and a molecular weight of 356.37 g/mol. Its IUPAC name is [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate |
| PubChem CID | 95973434 |
| Molecular Formula | C20H18F2N2O2 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate |
| SMILES | Cn1ccnc1[C@H](CCc1ccccc1)OC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H18F2N2O2/c1-24-12-11-23-19(24)18(10-7-14-5-3-2-4-6-14)26-20(25)16-9-8-15(21)13-17(16)22/h2-6,8-9,11-13,18H,7,10H2,1H3/t18-/m0/s1 |
| InChIKey | HDIJYFFVRIILGV-SFHVURJKSA-N |
| XLogP | 4.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate?
The IUPAC name of [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate (CID 95973434) is [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate.
What is the SMILES notation for [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate?
The canonical SMILES for [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate is Cn1ccnc1[C@H](CCc1ccccc1)OC(=O)c1ccc(F)cc1F.
What is the InChIKey of [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate?
The InChIKey is HDIJYFFVRIILGV-SFHVURJKSA-N. The full InChI is InChI=1S/C20H18F2N2O2/c1-24-12-11-23-19(24)18(10-7-14-5-3-2-4-6-14)26-20(25)16-9-8-15(21)13-17(16)22/h2-6,8-9,11-13,18H,7,10H2,1H3/t18-/m0/s1.
What are the key properties of [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate?
[(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate has a molecular weight of 356.37 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(1-methylimidazol-2-yl)-3-phenylpropyl] 2,4-difluorobenzoate is sourced from PubChem (CID 95973434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).