About N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide
N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide (PubChem CID 95974031) has the molecular formula C15H24N4O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide |
| PubChem CID | 95974031 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide |
| SMILES | CC(C)n1cc(NC(=O)C(=O)NC[C@H]2CCCC[C@H]2O)cn1 |
| InChI | InChI=1S/C15H24N4O3/c1-10(2)19-9-12(8-17-19)18-15(22)14(21)16-7-11-5-3-4-6-13(11)20/h8-11,13,20H,3-7H2,1-2H3,(H,16,21)(H,18,22)/t11-,13-/m1/s1 |
| InChIKey | GTDNAFDOTHVXLG-DGCLKSJQSA-N |
| XLogP | 1.07 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide?
The IUPAC name of N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide (CID 95974031) is N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide.
What is the SMILES notation for N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide?
The canonical SMILES for N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide is CC(C)n1cc(NC(=O)C(=O)NC[C@H]2CCCC[C@H]2O)cn1.
What is the InChIKey of N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide?
The InChIKey is GTDNAFDOTHVXLG-DGCLKSJQSA-N. The full InChI is InChI=1S/C15H24N4O3/c1-10(2)19-9-12(8-17-19)18-15(22)14(21)16-7-11-5-3-4-6-13(11)20/h8-11,13,20H,3-7H2,1-2H3,(H,16,21)(H,18,22)/t11-,13-/m1/s1.
What are the key properties of N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide?
N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide has a molecular weight of 308.38 g/mol, XLogP of 1.07, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-hydroxycyclohexyl]methyl]-N'-(1-propan-2-ylpyrazol-4-yl)oxamide is sourced from PubChem (CID 95974031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).