About N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide
N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide (PubChem CID 95974846) has the molecular formula C14H22N2O2S
and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide |
| PubChem CID | 95974846 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)CCN1CCNS(C)(=O)=O |
| InChI | InChI=1S/C14H22N2O2S/c1-12-14(13-6-4-3-5-7-13)8-10-16(12)11-9-15-19(2,17)18/h3-7,12,14-15H,8-11H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | CCGGQUSRDHSLMB-JSGCOSHPSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide (CID 95974846) is N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide is C[C@H]1[C@@H](c2ccccc2)CCN1CCNS(C)(=O)=O.
What is the InChIKey of N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide?
The InChIKey is CCGGQUSRDHSLMB-JSGCOSHPSA-N. The full InChI is InChI=1S/C14H22N2O2S/c1-12-14(13-6-4-3-5-7-13)8-10-16(12)11-9-15-19(2,17)18/h3-7,12,14-15H,8-11H2,1-2H3/t12-,14-/m0/s1.
What are the key properties of N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide?
N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide has a molecular weight of 282.41 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S,3R)-2-methyl-3-phenylpyrrolidin-1-yl]ethyl]methanesulfonamide is sourced from PubChem (CID 95974846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).