C19H22N2O2S — CID 95975009
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[(3R)-oxolan-3-yl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 95975009) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[(3R)-oxolan-3-yl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[(3R)-oxolan-3-yl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 95975009 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[(3R)-oxolan-3-yl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)N(CCc2ccccc2)[C@@H]2CCOC2)cs1 |
| InChI | InChI=1S/C19H22N2O2S/c1-15-20-17(14-24-15)7-8-19(22)21(18-10-12-23-13-18)11-9-16-5-3-2-4-6-16/h2-8,14,18H,9-13H2,1H3/b8-7+/t18-/m1/s1 |
| InChIKey | IYXGPIJPSQAMNY-LKGOPFMKSA-N |
| XLogP | 3.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|