About 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea
1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea (PubChem CID 95975313) has the molecular formula C10H15N3O2S2
and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea |
| PubChem CID | 95975313 |
| Molecular Formula | C10H15N3O2S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1cc(NC(=O)NC[C@H]2CSCCS2)on1 |
| InChI | InChI=1S/C10H15N3O2S2/c1-7-4-9(15-13-7)12-10(14)11-5-8-6-16-2-3-17-8/h4,8H,2-3,5-6H2,1H3,(H2,11,12,14)/t8-/m0/s1 |
| InChIKey | UWBQDZPNRLBBJM-QMMMGPOBSA-N |
| XLogP | 1.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea?
The IUPAC name of 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea (CID 95975313) is 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea.
What is the SMILES notation for 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea?
The canonical SMILES for 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea is Cc1cc(NC(=O)NC[C@H]2CSCCS2)on1.
What is the InChIKey of 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea?
The InChIKey is UWBQDZPNRLBBJM-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H15N3O2S2/c1-7-4-9(15-13-7)12-10(14)11-5-8-6-16-2-3-17-8/h4,8H,2-3,5-6H2,1H3,(H2,11,12,14)/t8-/m0/s1.
What are the key properties of 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea?
1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea has a molecular weight of 273.38 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-(3-methyl-1,2-oxazol-5-yl)urea is sourced from PubChem (CID 95975313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).